C11H12Cl3NO4S — CID 50895858
3-(2,4,5-trichloro-N-ethylsulfonylanilino)propanoic acid (PubChem CID 50895858) has the molecular formula C11H12Cl3NO4S and a molecular weight of 360.65 g/mol. Its IUPAC name is 3-(2,4,5-trichloro-N-ethylsulfonylanilino)propanoic acid.
| Compound Name | 3-(2,4,5-trichloro-N-ethylsulfonylanilino)propanoic acid |
|---|---|
| PubChem CID | 50895858 |
| Molecular Formula | C11H12Cl3NO4S |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 3-(2,4,5-trichloro-N-ethylsulfonylanilino)propanoic acid |
| SMILES | CCS(=O)(=O)N(CCC(=O)O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3NO4S/c1-2-20(18,19)15(4-3-11(16)17)10-6-8(13)7(12)5-9(10)14/h5-6H,2-4H2,1H3,(H,16,17) |
| InChIKey | AVPXCEVDJJTXTP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|