C12H15Cl2NO4S — CID 50892610
4-(2,6-dichloro-N-ethylsulfonylanilino)butanoic acid (PubChem CID 50892610) has the molecular formula C12H15Cl2NO4S and a molecular weight of 340.23 g/mol. Its IUPAC name is 4-(2,6-dichloro-N-ethylsulfonylanilino)butanoic acid.
| Compound Name | 4-(2,6-dichloro-N-ethylsulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 50892610 |
| Molecular Formula | C12H15Cl2NO4S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-(2,6-dichloro-N-ethylsulfonylanilino)butanoic acid |
| SMILES | CCS(=O)(=O)N(CCCC(=O)O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H15Cl2NO4S/c1-2-20(18,19)15(8-4-7-11(16)17)12-9(13)5-3-6-10(12)14/h3,5-6H,2,4,7-8H2,1H3,(H,16,17) |
| InChIKey | HNRQCJJEBZTSKZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |