C11H14INO4S — CID 50891135
3-(N-ethylsulfonyl-4-iodoanilino)propanoic acid (PubChem CID 50891135) has the molecular formula C11H14INO4S and a molecular weight of 383.21 g/mol. Its IUPAC name is 3-(N-ethylsulfonyl-4-iodoanilino)propanoic acid.
| Compound Name | 3-(N-ethylsulfonyl-4-iodoanilino)propanoic acid |
|---|---|
| PubChem CID | 50891135 |
| Molecular Formula | C11H14INO4S |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 3-(N-ethylsulfonyl-4-iodoanilino)propanoic acid |
| SMILES | CCS(=O)(=O)N(CCC(=O)O)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H14INO4S/c1-2-18(16,17)13(8-7-11(14)15)10-5-3-9(12)4-6-10/h3-6H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | LRGVNGLVSJZUDM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|