C19H18Cl2O4 — CID 10667517
ethyl 4,5-bis(4-chlorophenyl)-4-hydroxy-5-oxopentanoate (PubChem CID 10667517) has the molecular formula C19H18Cl2O4 and a molecular weight of 381.26 g/mol. Its IUPAC name is ethyl 4,5-bis(4-chlorophenyl)-4-hydroxy-5-oxopentanoate.
| Compound Name | ethyl 4,5-bis(4-chlorophenyl)-4-hydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 10667517 |
| Molecular Formula | C19H18Cl2O4 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | ethyl 4,5-bis(4-chlorophenyl)-4-hydroxy-5-oxopentanoate |
| SMILES | CCOC(=O)CCC(O)(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2O4/c1-2-25-17(22)11-12-19(24,14-5-9-16(21)10-6-14)18(23)13-3-7-15(20)8-4-13/h3-10,24H,2,11-12H2,1H3 |
| InChIKey | MESZHILNXADBCR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |