C18H16Cl2O3 — CID 10594061
1,2-bis(4-chlorophenyl)-2-hydroxyhexane-1,5-dione (PubChem CID 10594061) has the molecular formula C18H16Cl2O3 and a molecular weight of 351.23 g/mol. Its IUPAC name is 1,2-bis(4-chlorophenyl)-2-hydroxyhexane-1,5-dione.
| Compound Name | 1,2-bis(4-chlorophenyl)-2-hydroxyhexane-1,5-dione |
|---|---|
| PubChem CID | 10594061 |
| Molecular Formula | C18H16Cl2O3 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 1,2-bis(4-chlorophenyl)-2-hydroxyhexane-1,5-dione |
| SMILES | CC(=O)CCC(O)(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2O3/c1-12(21)10-11-18(23,14-4-8-16(20)9-5-14)17(22)13-2-6-15(19)7-3-13/h2-9,23H,10-11H2,1H3 |
| InChIKey | JYIQIWNGHUBJGK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |