About triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate
triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate (PubChem CID 141498975) has the molecular formula C19H23ClO8
and a molecular weight of 414.84 g/mol. Its IUPAC name is triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate.
Molecular Properties
| Compound Name | triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate |
| PubChem CID | 141498975 |
| Molecular Formula | C19H23ClO8 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(O)(C(=O)OCC)C(C(=O)OCC)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClO8/c1-4-26-14(21)11-19(25,18(24)28-6-3)15(17(23)27-5-2)16(22)12-7-9-13(20)10-8-12/h7-10,15,25H,4-6,11H2,1-3H3 |
| InChIKey | FEUBVFOLRLIOAL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate?
The IUPAC name of triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate (CID 141498975) is triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate.
What is the SMILES notation for triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate?
The canonical SMILES for triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate is CCOC(=O)CC(O)(C(=O)OCC)C(C(=O)OCC)C(=O)c1ccc(Cl)cc1.
What is the InChIKey of triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate?
The InChIKey is FEUBVFOLRLIOAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClO8/c1-4-26-14(21)11-19(25,18(24)28-6-3)15(17(23)27-5-2)16(22)12-7-9-13(20)10-8-12/h7-10,15,25H,4-6,11H2,1-3H3.
What are the key properties of triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate?
triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate has a molecular weight of 414.84 g/mol, XLogP of 1.95, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate is sourced from PubChem (CID 141498975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).