C19H23ClO8 — CID 141498975
triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate (PubChem CID 141498975) has the molecular formula C19H23ClO8 and a molecular weight of 414.84 g/mol. Its IUPAC name is triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate.
| Compound Name | triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 141498975 |
| Molecular Formula | C19H23ClO8 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | triethyl 4-(4-chlorophenyl)-2-hydroxy-4-oxobutane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(O)(C(=O)OCC)C(C(=O)OCC)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClO8/c1-4-26-14(21)11-19(25,18(24)28-6-3)15(17(23)27-5-2)16(22)12-7-9-13(20)10-8-12/h7-10,15,25H,4-6,11H2,1-3H3 |
| InChIKey | FEUBVFOLRLIOAL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|