C20H26O8 — CID 141498937
triethyl 2-hydroxy-4-(4-methylphenyl)-4-oxobutane-1,2,3-tricarboxylate (PubChem CID 141498937) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is triethyl 2-hydroxy-4-(4-methylphenyl)-4-oxobutane-1,2,3-tricarboxylate.
| Compound Name | triethyl 2-hydroxy-4-(4-methylphenyl)-4-oxobutane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 141498937 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | triethyl 2-hydroxy-4-(4-methylphenyl)-4-oxobutane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(O)(C(=O)OCC)C(C(=O)OCC)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H26O8/c1-5-26-15(21)12-20(25,19(24)28-7-3)16(18(23)27-6-2)17(22)14-10-8-13(4)9-11-14/h8-11,16,25H,5-7,12H2,1-4H3 |
| InChIKey | YYJBVOJAJAEXDX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|