C20H34O8 — CID 10222764
tributyl 2-hydroxy-4-oxopentane-1,2,3-tricarboxylate (PubChem CID 10222764) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is tributyl 2-hydroxy-4-oxopentane-1,2,3-tricarboxylate.
| Compound Name | tributyl 2-hydroxy-4-oxopentane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 10222764 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | tributyl 2-hydroxy-4-oxopentane-1,2,3-tricarboxylate |
| SMILES | CCCCOC(=O)CC(O)(C(=O)OCCCC)C(C(C)=O)C(=O)OCCCC |
| InChI | InChI=1S/C20H34O8/c1-5-8-11-26-16(22)14-20(25,19(24)28-13-10-7-3)17(15(4)21)18(23)27-12-9-6-2/h17,25H,5-14H2,1-4H3 |
| InChIKey | PESZCXUNMKAYME-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|