C32H58O8 — CID 22287942
trioctyl 2-hydroxy-4-oxopentane-1,2,3-tricarboxylate (PubChem CID 22287942) has the molecular formula C32H58O8 and a molecular weight of 570.81 g/mol. Its IUPAC name is trioctyl 2-hydroxy-4-oxopentane-1,2,3-tricarboxylate.
| Compound Name | trioctyl 2-hydroxy-4-oxopentane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 22287942 |
| Molecular Formula | C32H58O8 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | trioctyl 2-hydroxy-4-oxopentane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCCOC(=O)CC(O)(C(=O)OCCCCCCCC)C(C(C)=O)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C32H58O8/c1-5-8-11-14-17-20-23-38-28(34)26-32(37,31(36)40-25-22-19-16-13-10-7-3)29(27(4)33)30(35)39-24-21-18-15-12-9-6-2/h29,37H,5-26H2,1-4H3 |
| InChIKey | LNYCJZRLMAMTQW-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|