C16H22Cl2N2O4 — CID 71594085
ethyl (1E)-2-(3,4-dichlorophenyl)-2-hydroxy-N-[(2-methylpropan-2-yl)oxycarbonyl]propanehydrazonate (PubChem CID 71594085) has the molecular formula C16H22Cl2N2O4 and a molecular weight of 377.27 g/mol. Its IUPAC name is ethyl (1E)-2-(3,4-dichlorophenyl)-2-hydroxy-N-[(2-methylpropan-2-yl)oxycarbonyl]propanehydrazonate.
| Compound Name | ethyl (1E)-2-(3,4-dichlorophenyl)-2-hydroxy-N-[(2-methylpropan-2-yl)oxycarbonyl]propanehydrazonate |
|---|---|
| PubChem CID | 71594085 |
| Molecular Formula | C16H22Cl2N2O4 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | ethyl (1E)-2-(3,4-dichlorophenyl)-2-hydroxy-N-[(2-methylpropan-2-yl)oxycarbonyl]propanehydrazonate |
| SMILES | CCO/C(=N/NC(=O)OC(C)(C)C)C(C)(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2N2O4/c1-6-23-13(19-20-14(21)24-15(2,3)4)16(5,22)10-7-8-11(17)12(18)9-10/h7-9,22H,6H2,1-5H3,(H,20,21)/b19-13+ |
| InChIKey | LDAUDIDXNCOVMU-CPNJWEJPSA-N |
| XLogP | 4.08 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|