C15H18F3NO2 — CID 117049245
ethyl 2-[2-amino-4-(trifluoromethyl)phenyl]-2-methylpent-4-enoate (PubChem CID 117049245) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is ethyl 2-[2-amino-4-(trifluoromethyl)phenyl]-2-methylpent-4-enoate.
| Compound Name | ethyl 2-[2-amino-4-(trifluoromethyl)phenyl]-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 117049245 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | ethyl 2-[2-amino-4-(trifluoromethyl)phenyl]-2-methylpent-4-enoate |
| SMILES | C=CCC(C)(C(=O)OCC)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C15H18F3NO2/c1-4-8-14(3,13(20)21-5-2)11-7-6-10(9-12(11)19)15(16,17)18/h4,6-7,9H,1,5,8,19H2,2-3H3 |
| InChIKey | WKTVNHCLVRWDRY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|