C12H14F2O2S — CID 116853899
ethyl 2-(3,4-difluorophenyl)sulfanyl-2-methylpropanoate (PubChem CID 116853899) has the molecular formula C12H14F2O2S and a molecular weight of 260.30 g/mol. Its IUPAC name is ethyl 2-(3,4-difluorophenyl)sulfanyl-2-methylpropanoate.
| Compound Name | ethyl 2-(3,4-difluorophenyl)sulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 116853899 |
| Molecular Formula | C12H14F2O2S |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | ethyl 2-(3,4-difluorophenyl)sulfanyl-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2O2S/c1-4-16-11(15)12(2,3)17-8-5-6-9(13)10(14)7-8/h5-7H,4H2,1-3H3 |
| InChIKey | RLIUPEHWWSDWDS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |