C11H11F2NO4 — CID 79888631
4-[2-(dimethylamino)-2-oxoethoxy]-3,5-difluorobenzoic acid (PubChem CID 79888631) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 4-[2-(dimethylamino)-2-oxoethoxy]-3,5-difluorobenzoic acid.
| Compound Name | 4-[2-(dimethylamino)-2-oxoethoxy]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 79888631 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-[2-(dimethylamino)-2-oxoethoxy]-3,5-difluorobenzoic acid |
| SMILES | CN(C)C(=O)COc1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C11H11F2NO4/c1-14(2)9(15)5-18-10-7(12)3-6(11(16)17)4-8(10)13/h3-4H,5H2,1-2H3,(H,16,17) |
| InChIKey | QYLZGPAZIONQFD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |