C12H20N2O — CID 81059669
3-N-(2-ethoxyethyl)-3-N,2-dimethylbenzene-1,3-diamine (PubChem CID 81059669) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-N-(2-ethoxyethyl)-3-N,2-dimethylbenzene-1,3-diamine.
| Compound Name | 3-N-(2-ethoxyethyl)-3-N,2-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 81059669 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3-N-(2-ethoxyethyl)-3-N,2-dimethylbenzene-1,3-diamine |
| SMILES | CCOCCN(C)c1cccc(N)c1C |
| InChI | InChI=1S/C12H20N2O/c1-4-15-9-8-14(3)12-7-5-6-11(13)10(12)2/h5-7H,4,8-9,13H2,1-3H3 |
| InChIKey | HBWLOWLLEZKYJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|