C14H21F2N3 — CID 55086413
2-N-(1-ethylpiperidin-4-yl)-3,4-difluoro-2-N-methylbenzene-1,2-diamine (PubChem CID 55086413) has the molecular formula C14H21F2N3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-N-(1-ethylpiperidin-4-yl)-3,4-difluoro-2-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(1-ethylpiperidin-4-yl)-3,4-difluoro-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 55086413 |
| Molecular Formula | C14H21F2N3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-N-(1-ethylpiperidin-4-yl)-3,4-difluoro-2-N-methylbenzene-1,2-diamine |
| SMILES | CCN1CCC(N(C)c2c(N)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C14H21F2N3/c1-3-19-8-6-10(7-9-19)18(2)14-12(17)5-4-11(15)13(14)16/h4-5,10H,3,6-9,17H2,1-2H3 |
| InChIKey | QOOJVINRNVSKIE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|