C13H19F2N3 — CID 62531948
3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine (PubChem CID 62531948) has the molecular formula C13H19F2N3 and a molecular weight of 255.31 g/mol. Its IUPAC name is 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine.
| Compound Name | 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 62531948 |
| Molecular Formula | C13H19F2N3 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine |
| SMILES | CN1CCC(N(C)c2c(N)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C13H19F2N3/c1-17-7-5-9(6-8-17)18(2)13-11(16)4-3-10(14)12(13)15/h3-4,9H,5-8,16H2,1-2H3 |
| InChIKey | ZFHCDUDLEVPLRC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|