About 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine
3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine (PubChem CID 62531948) has the molecular formula C13H19F2N3
and a molecular weight of 255.31 g/mol. Its IUPAC name is 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine |
| PubChem CID | 62531948 |
| Molecular Formula | C13H19F2N3 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine |
| SMILES | CN1CCC(N(C)c2c(N)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C13H19F2N3/c1-17-7-5-9(6-8-17)18(2)13-11(16)4-3-10(14)12(13)15/h3-4,9H,5-8,16H2,1-2H3 |
| InChIKey | ZFHCDUDLEVPLRC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine?
The IUPAC name of 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine (CID 62531948) is 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine.
What is the SMILES notation for 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine?
The canonical SMILES for 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine is CN1CCC(N(C)c2c(N)ccc(F)c2F)CC1.
What is the InChIKey of 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine?
The InChIKey is ZFHCDUDLEVPLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2N3/c1-17-7-5-9(6-8-17)18(2)13-11(16)4-3-10(14)12(13)15/h3-4,9H,5-8,16H2,1-2H3.
What are the key properties of 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine?
3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine has a molecular weight of 255.31 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoro-2-N-methyl-2-N-(1-methylpiperidin-4-yl)benzene-1,2-diamine is sourced from PubChem (CID 62531948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).