C13H21ClFN3O — CID 103552877
5-chloro-6-fluoro-1-N-(2-methoxyethyl)-1-N-(2-methylpropyl)benzene-1,2,4-triamine (PubChem CID 103552877) has the molecular formula C13H21ClFN3O and a molecular weight of 289.78 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-N-(2-methoxyethyl)-1-N-(2-methylpropyl)benzene-1,2,4-triamine.
| Compound Name | 5-chloro-6-fluoro-1-N-(2-methoxyethyl)-1-N-(2-methylpropyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103552877 |
| Molecular Formula | C13H21ClFN3O |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-chloro-6-fluoro-1-N-(2-methoxyethyl)-1-N-(2-methylpropyl)benzene-1,2,4-triamine |
| SMILES | COCCN(CC(C)C)c1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C13H21ClFN3O/c1-8(2)7-18(4-5-19-3)13-10(17)6-9(16)11(14)12(13)15/h6,8H,4-5,7,16-17H2,1-3H3 |
| InChIKey | PIFZLANVJOKUTC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|