C12H15FN2O2 — CID 166524679
methyl 3-amino-4-(cyclopropylmethylamino)-5-fluorobenzoate (PubChem CID 166524679) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is methyl 3-amino-4-(cyclopropylmethylamino)-5-fluorobenzoate.
| Compound Name | methyl 3-amino-4-(cyclopropylmethylamino)-5-fluorobenzoate |
|---|---|
| PubChem CID | 166524679 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | methyl 3-amino-4-(cyclopropylmethylamino)-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(N)c(NCC2CC2)c(F)c1 |
| InChI | InChI=1S/C12H15FN2O2/c1-17-12(16)8-4-9(13)11(10(14)5-8)15-6-7-2-3-7/h4-5,7,15H,2-3,6,14H2,1H3 |
| InChIKey | MNZPPPLKQFFKND-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|