C12H13F3N2O2 — CID 167290195
methyl 3-amino-4-[[(1S)-2-(difluoromethyl)cyclopropyl]amino]-5-fluorobenzoate (PubChem CID 167290195) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is methyl 3-amino-4-[[(1S)-2-(difluoromethyl)cyclopropyl]amino]-5-fluorobenzoate.
| Compound Name | methyl 3-amino-4-[[(1S)-2-(difluoromethyl)cyclopropyl]amino]-5-fluorobenzoate |
|---|---|
| PubChem CID | 167290195 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | methyl 3-amino-4-[[(1S)-2-(difluoromethyl)cyclopropyl]amino]-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(N)c(N[C@H]2CC2C(F)F)c(F)c1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-19-12(18)5-2-7(13)10(8(16)3-5)17-9-4-6(9)11(14)15/h2-3,6,9,11,17H,4,16H2,1H3/t6?,9-/m0/s1 |
| InChIKey | DTVUOXPMGCZCMS-HSOSERFQSA-N |
| XLogP | 2.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|