C17H19FN4O2 — CID 133449615
methyl 3-[[[6-(cyclopropylmethylamino)pyrimidin-4-yl]amino]methyl]-4-fluorobenzoate (PubChem CID 133449615) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is methyl 3-[[[6-(cyclopropylmethylamino)pyrimidin-4-yl]amino]methyl]-4-fluorobenzoate.
| Compound Name | methyl 3-[[[6-(cyclopropylmethylamino)pyrimidin-4-yl]amino]methyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 133449615 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | methyl 3-[[[6-(cyclopropylmethylamino)pyrimidin-4-yl]amino]methyl]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(CNc2cc(NCC3CC3)ncn2)c1 |
| InChI | InChI=1S/C17H19FN4O2/c1-24-17(23)12-4-5-14(18)13(6-12)9-20-16-7-15(21-10-22-16)19-8-11-2-3-11/h4-7,10-11H,2-3,8-9H2,1H3,(H2,19,20,21,22) |
| InChIKey | JRVUUJSSQBPUER-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |