C19H14FN3O2 — CID 133449651
methyl 3-[[(6-cyanoquinolin-2-yl)amino]methyl]-4-fluorobenzoate (PubChem CID 133449651) has the molecular formula C19H14FN3O2 and a molecular weight of 335.34 g/mol. Its IUPAC name is methyl 3-[[(6-cyanoquinolin-2-yl)amino]methyl]-4-fluorobenzoate.
| Compound Name | methyl 3-[[(6-cyanoquinolin-2-yl)amino]methyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 133449651 |
| Molecular Formula | C19H14FN3O2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | methyl 3-[[(6-cyanoquinolin-2-yl)amino]methyl]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(CNc2ccc3cc(C#N)ccc3n2)c1 |
| InChI | InChI=1S/C19H14FN3O2/c1-25-19(24)14-3-5-16(20)15(9-14)11-22-18-7-4-13-8-12(10-21)2-6-17(13)23-18/h2-9H,11H2,1H3,(H,22,23) |
| InChIKey | HLPBRVJGOWXIRT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |