C15H12FN5O4 — CID 133449690
methyl 4-fluoro-3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]benzoate (PubChem CID 133449690) has the molecular formula C15H12FN5O4 and a molecular weight of 345.29 g/mol. Its IUPAC name is methyl 4-fluoro-3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]benzoate.
| Compound Name | methyl 4-fluoro-3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 133449690 |
| Molecular Formula | C15H12FN5O4 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | methyl 4-fluoro-3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(F)c(CNc2ccc3ncc([N+](=O)[O-])n3n2)c1 |
| InChI | InChI=1S/C15H12FN5O4/c1-25-15(22)9-2-3-11(16)10(6-9)7-17-12-4-5-13-18-8-14(21(23)24)20(13)19-12/h2-6,8H,7H2,1H3,(H,17,19) |
| InChIKey | XYHJNNUVZYNZRY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|