About 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol
3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol (PubChem CID 133419413) has the molecular formula C12H17N5O3
and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol.
Molecular Properties
| Compound Name | 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol |
| PubChem CID | 133419413 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol |
| SMILES | CCC(CCO)CNc1ccc2ncc([N+](=O)[O-])n2n1 |
| InChI | InChI=1S/C12H17N5O3/c1-2-9(5-6-18)7-13-10-3-4-11-14-8-12(17(19)20)16(11)15-10/h3-4,8-9,18H,2,5-7H2,1H3,(H,13,15) |
| InChIKey | UDDZTFYWCVHFFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol?
The IUPAC name of 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol (CID 133419413) is 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol.
What is the SMILES notation for 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol?
The canonical SMILES for 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol is CCC(CCO)CNc1ccc2ncc([N+](=O)[O-])n2n1.
What is the InChIKey of 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol?
The InChIKey is UDDZTFYWCVHFFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O3/c1-2-9(5-6-18)7-13-10-3-4-11-14-8-12(17(19)20)16(11)15-10/h3-4,8-9,18H,2,5-7H2,1H3,(H,13,15).
What are the key properties of 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol?
3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol has a molecular weight of 279.30 g/mol, XLogP of 1.46, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3-nitroimidazo[1,2-b]pyridazin-6-yl)amino]methyl]pentan-1-ol is sourced from PubChem (CID 133419413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).