C17H17N5 — CID 133444982
2-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]quinoline-6-carbonitrile (PubChem CID 133444982) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]quinoline-6-carbonitrile.
| Compound Name | 2-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 133444982 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]quinoline-6-carbonitrile |
| SMILES | CCc1nn(C)cc1CNc1ccc2cc(C#N)ccc2n1 |
| InChI | InChI=1S/C17H17N5/c1-3-15-14(11-22(2)21-15)10-19-17-7-5-13-8-12(9-18)4-6-16(13)20-17/h4-8,11H,3,10H2,1-2H3,(H,19,20) |
| InChIKey | ZYXZXUDPGGMBLL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |