C15H13N5 — CID 75505975
2-(2-imidazol-1-ylethylamino)quinoline-6-carbonitrile (PubChem CID 75505975) has the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-(2-imidazol-1-ylethylamino)quinoline-6-carbonitrile.
| Compound Name | 2-(2-imidazol-1-ylethylamino)quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 75505975 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(2-imidazol-1-ylethylamino)quinoline-6-carbonitrile |
| SMILES | N#Cc1ccc2nc(NCCn3ccnc3)ccc2c1 |
| InChI | InChI=1S/C15H13N5/c16-10-12-1-3-14-13(9-12)2-4-15(19-14)18-6-8-20-7-5-17-11-20/h1-5,7,9,11H,6,8H2,(H,18,19) |
| InChIKey | PYPUYCDIJOPDLP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |