C15H18N4 — CID 43773848
3-[1-(3-imidazol-1-ylpropylamino)ethyl]benzonitrile (PubChem CID 43773848) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-[1-(3-imidazol-1-ylpropylamino)ethyl]benzonitrile.
| Compound Name | 3-[1-(3-imidazol-1-ylpropylamino)ethyl]benzonitrile |
|---|---|
| PubChem CID | 43773848 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-[1-(3-imidazol-1-ylpropylamino)ethyl]benzonitrile |
| SMILES | CC(NCCCn1ccnc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N4/c1-13(15-5-2-4-14(10-15)11-16)18-6-3-8-19-9-7-17-12-19/h2,4-5,7,9-10,12-13,18H,3,6,8H2,1H3 |
| InChIKey | VQERIKOZEDMHRO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|