C18H17N5 — CID 97336131
3-[(1S)-1-[(2-imidazol-1-yl-4-pyridinyl)methylamino]ethyl]benzonitrile (PubChem CID 97336131) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-imidazol-1-yl-4-pyridinyl)methylamino]ethyl]benzonitrile.
| Compound Name | 3-[(1S)-1-[(2-imidazol-1-yl-4-pyridinyl)methylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 97336131 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-[(1S)-1-[(2-imidazol-1-yl-4-pyridinyl)methylamino]ethyl]benzonitrile |
| SMILES | C[C@H](NCc1ccnc(-n2ccnc2)c1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C18H17N5/c1-14(17-4-2-3-15(9-17)11-19)22-12-16-5-6-21-18(10-16)23-8-7-20-13-23/h2-10,13-14,22H,12H2,1H3/t14-/m0/s1 |
| InChIKey | KECACXHFWSZDCQ-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |