C11H9ClF3NO3 — CID 91649732
methyl 3-[[(2-chloro-2,2-difluoroacetyl)amino]methyl]-4-fluorobenzoate (PubChem CID 91649732) has the molecular formula C11H9ClF3NO3 and a molecular weight of 295.64 g/mol. Its IUPAC name is methyl 3-[[(2-chloro-2,2-difluoroacetyl)amino]methyl]-4-fluorobenzoate.
| Compound Name | methyl 3-[[(2-chloro-2,2-difluoroacetyl)amino]methyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 91649732 |
| Molecular Formula | C11H9ClF3NO3 |
| Molecular Weight | 295.64 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | methyl 3-[[(2-chloro-2,2-difluoroacetyl)amino]methyl]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(CNC(=O)C(F)(F)Cl)c1 |
| InChI | InChI=1S/C11H9ClF3NO3/c1-19-9(17)6-2-3-8(13)7(4-6)5-16-10(18)11(12,14)15/h2-4H,5H2,1H3,(H,16,18) |
| InChIKey | WVNONNRLOLUUOO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.64 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|