C25H27ClF2O4 — CID 158759970
chloro 4-fluoro-3-(3-methylbut-2-enyl)benzoate;methyl 4-fluoro-3-(3-methylbut-2-enyl)benzoate (PubChem CID 158759970) has the molecular formula C25H27ClF2O4 and a molecular weight of 464.94 g/mol. Its IUPAC name is chloro 4-fluoro-3-(3-methylbut-2-enyl)benzoate;methyl 4-fluoro-3-(3-methylbut-2-enyl)benzoate.
| Compound Name | chloro 4-fluoro-3-(3-methylbut-2-enyl)benzoate;methyl 4-fluoro-3-(3-methylbut-2-enyl)benzoate |
|---|---|
| PubChem CID | 158759970 |
| Molecular Formula | C25H27ClF2O4 |
| Molecular Weight | 464.94 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | chloro 4-fluoro-3-(3-methylbut-2-enyl)benzoate;methyl 4-fluoro-3-(3-methylbut-2-enyl)benzoate |
| SMILES | CC(C)=CCc1cc(C(=O)OCl)ccc1F.COC(=O)c1ccc(F)c(CC=C(C)C)c1 |
| InChI | InChI=1S/C13H15FO2.C12H12ClFO2/c1-9(2)4-5-10-8-11(13(15)16-3)6-7-12(10)14;1-8(2)3-4-9-7-10(12(15)16-13)5-6-11(9)14/h4,6-8H,5H2,1-3H3;3,5-7H,4H2,1-2H3 |
| InChIKey | IONTYCXQRDCPLV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.94 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|