C15H21NO3 — CID 107303203
2,3-dihydroxy-N-[(3-methylcyclohexyl)methyl]benzamide (PubChem CID 107303203) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[(3-methylcyclohexyl)methyl]benzamide.
| Compound Name | 2,3-dihydroxy-N-[(3-methylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 107303203 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2,3-dihydroxy-N-[(3-methylcyclohexyl)methyl]benzamide |
| SMILES | CC1CCCC(CNC(=O)c2cccc(O)c2O)C1 |
| InChI | InChI=1S/C15H21NO3/c1-10-4-2-5-11(8-10)9-16-15(19)12-6-3-7-13(17)14(12)18/h3,6-7,10-11,17-18H,2,4-5,8-9H2,1H3,(H,16,19) |
| InChIKey | XBGVYASTMOOMCS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|