C15H20ClNO3 — CID 65119441
5-chloro-2-hydroxy-N-[(1-hydroxy-4-methylcyclohexyl)methyl]benzamide (PubChem CID 65119441) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-[(1-hydroxy-4-methylcyclohexyl)methyl]benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-[(1-hydroxy-4-methylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 65119441 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5-chloro-2-hydroxy-N-[(1-hydroxy-4-methylcyclohexyl)methyl]benzamide |
| SMILES | CC1CCC(O)(CNC(=O)c2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C15H20ClNO3/c1-10-4-6-15(20,7-5-10)9-17-14(19)12-8-11(16)2-3-13(12)18/h2-3,8,10,18,20H,4-7,9H2,1H3,(H,17,19) |
| InChIKey | YGJFFZRWMGNWCF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |