C16H14Cl2N4O2 — CID 6619178
5-(3,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide (PubChem CID 6619178) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 6619178 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cc(-c2ccc(Cl)c(Cl)c2)on1 |
| InChI | InChI=1S/C16H14Cl2N4O2/c17-12-3-2-11(8-13(12)18)15-9-14(21-24-15)16(23)20-4-1-6-22-7-5-19-10-22/h2-3,5,7-10H,1,4,6H2,(H,20,23) |
| InChIKey | CYCBIJJVHKJPSK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|