C16H24Cl2N4O — CID 111306373
2-[[[(3,4-dichlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-propylacetamide (PubChem CID 111306373) has the molecular formula C16H24Cl2N4O and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-[[[(3,4-dichlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-propylacetamide.
| Compound Name | 2-[[[(3,4-dichlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 111306373 |
| Molecular Formula | C16H24Cl2N4O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-[[[(3,4-dichlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)C/N=C(\NCC)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H24Cl2N4O/c1-4-8-20-15(23)10-21-16(19-5-2)22(3)11-12-6-7-13(17)14(18)9-12/h6-7,9H,4-5,8,10-11H2,1-3H3,(H,19,21)(H,20,23) |
| InChIKey | LEDQJJYWBBZDEA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|