C16H24Cl2N4O2S — CID 111306399
1-[(3,4-dichlorophenyl)methyl]-2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-1-methylguanidine (PubChem CID 111306399) has the molecular formula C16H24Cl2N4O2S and a molecular weight of 407.37 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-1-methylguanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111306399 |
| Molecular Formula | C16H24Cl2N4O2S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\CCN1CCCS1(=O)=O)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H24Cl2N4O2S/c1-3-19-16(20-7-9-22-8-4-10-25(22,23)24)21(2)12-13-5-6-14(17)15(18)11-13/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,19,20) |
| InChIKey | NBYOQMFDLGSTFY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|