C15H23ClN4O2S — CID 111305473
1-[(3-chlorophenyl)methyl]-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1,2-dimethylguanidine (PubChem CID 111305473) has the molecular formula C15H23ClN4O2S and a molecular weight of 358.90 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111305473 |
| Molecular Formula | C15H23ClN4O2S |
| Molecular Weight | 358.90 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCN1CCCS1(=O)=O)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClN4O2S/c1-17-15(18-7-9-20-8-4-10-23(20,21)22)19(2)12-13-5-3-6-14(16)11-13/h3,5-6,11H,4,7-10,12H2,1-2H3,(H,17,18) |
| InChIKey | IMXZKEXIWOIMHB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.90 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|