C17H25ClN4O2S — CID 111640468
1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methylguanidine (PubChem CID 111640468) has the molecular formula C17H25ClN4O2S and a molecular weight of 384.93 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111640468 |
| Molecular Formula | C17H25ClN4O2S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN1CCCS1(=O)=O)NCC1(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25ClN4O2S/c1-19-16(20-8-10-22-9-3-11-25(22,23)24)21-13-17(6-7-17)14-4-2-5-15(18)12-14/h2,4-5,12H,3,6-11,13H2,1H3,(H2,19,20,21) |
| InChIKey | KAPAJYUZLQOUGA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|