C16H24ClIN6 — CID 111514959
1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111514959) has the molecular formula C16H24ClIN6 and a molecular weight of 462.77 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111514959 |
| Molecular Formula | C16H24ClIN6 |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCn1cnnc1)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C16H23ClN6.HI/c1-18-16(19-8-3-4-9-23-12-20-21-13-23)22(2)11-14-6-5-7-15(17)10-14;/h5-7,10,12-13H,3-4,8-9,11H2,1-2H3,(H,18,19);1H |
| InChIKey | FRFTUSIKUGQROB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|