C21H34Cl2IN5O — CID 111306100
1-[4-[[[(3,4-dichlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111306100) has the molecular formula C21H34Cl2IN5O and a molecular weight of 570.35 g/mol. Its IUPAC name is 1-[4-[[[(3,4-dichlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[[(3,4-dichlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111306100 |
| Molecular Formula | C21H34Cl2IN5O |
| Molecular Weight | 570.35 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 1-[4-[[[(3,4-dichlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCC(C(N)=O)CC1)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C21H33Cl2N5O.HI/c1-3-25-21(27(2)15-16-6-7-18(22)19(23)14-16)26-10-4-5-11-28-12-8-17(9-13-28)20(24)29;/h6-7,14,17H,3-5,8-13,15H2,1-2H3,(H2,24,29)(H,25,26);1H |
| InChIKey | QZDWPPWNWDMKNN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|