C18H21ClN2O2S — CID 34132705
N-[4-[(5-chlorothiophen-2-yl)methyl-ethylamino]-4-oxobutyl]benzamide (PubChem CID 34132705) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is N-[4-[(5-chlorothiophen-2-yl)methyl-ethylamino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[(5-chlorothiophen-2-yl)methyl-ethylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 34132705 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[4-[(5-chlorothiophen-2-yl)methyl-ethylamino]-4-oxobutyl]benzamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)CCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-2-21(13-15-10-11-16(19)24-15)17(22)9-6-12-20-18(23)14-7-4-3-5-8-14/h3-5,7-8,10-11H,2,6,9,12-13H2,1H3,(H,20,23) |
| InChIKey | AHFDPRZHOIZXSB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|