C13H19ClN2OS — CID 54869490
N-[(5-chlorothiophen-2-yl)methyl]-4-(methylamino)-N-prop-2-enylbutanamide (PubChem CID 54869490) has the molecular formula C13H19ClN2OS and a molecular weight of 286.83 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-4-(methylamino)-N-prop-2-enylbutanamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-4-(methylamino)-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 54869490 |
| Molecular Formula | C13H19ClN2OS |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-4-(methylamino)-N-prop-2-enylbutanamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)CCCNC |
| InChI | InChI=1S/C13H19ClN2OS/c1-3-9-16(13(17)5-4-8-15-2)10-11-6-7-12(14)18-11/h3,6-7,15H,1,4-5,8-10H2,2H3 |
| InChIKey | NPNZQBKGPVTPBL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|