C12H20Cl2N2OS — CID 120559212
4-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylpentanamide;hydrochloride (PubChem CID 120559212) has the molecular formula C12H20Cl2N2OS and a molecular weight of 311.28 g/mol. Its IUPAC name is 4-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylpentanamide;hydrochloride.
| Compound Name | 4-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 120559212 |
| Molecular Formula | C12H20Cl2N2OS |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylpentanamide;hydrochloride |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)CCC(C)N.Cl |
| InChI | InChI=1S/C12H19ClN2OS.ClH/c1-3-15(12(16)7-4-9(2)14)8-10-5-6-11(13)17-10;/h5-6,9H,3-4,7-8,14H2,1-2H3;1H |
| InChIKey | NUNHYHSTRUWBNJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |