C13H21ClN2OS — CID 82852185
5-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylhexanamide (PubChem CID 82852185) has the molecular formula C13H21ClN2OS and a molecular weight of 288.84 g/mol. Its IUPAC name is 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylhexanamide.
| Compound Name | 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylhexanamide |
|---|---|
| PubChem CID | 82852185 |
| Molecular Formula | C13H21ClN2OS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylhexanamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)CCCC(C)N |
| InChI | InChI=1S/C13H21ClN2OS/c1-3-16(9-11-7-8-12(14)18-11)13(17)6-4-5-10(2)15/h7-8,10H,3-6,9,15H2,1-2H3 |
| InChIKey | OUCTUKIZUFDUSV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |