C15H23ClN2O — CID 82852385
5-amino-N-[(3-chlorophenyl)methyl]-N-ethylhexanamide (PubChem CID 82852385) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 5-amino-N-[(3-chlorophenyl)methyl]-N-ethylhexanamide.
| Compound Name | 5-amino-N-[(3-chlorophenyl)methyl]-N-ethylhexanamide |
|---|---|
| PubChem CID | 82852385 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-amino-N-[(3-chlorophenyl)methyl]-N-ethylhexanamide |
| SMILES | CCN(Cc1cccc(Cl)c1)C(=O)CCCC(C)N |
| InChI | InChI=1S/C15H23ClN2O/c1-3-18(15(19)9-4-6-12(2)17)11-13-7-5-8-14(16)10-13/h5,7-8,10,12H,3-4,6,9,11,17H2,1-2H3 |
| InChIKey | HXTZJARQPSEQNT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |