C29H45N3O2+2 — CID 158146250
(4-ethylphenyl)methyl-dimethyl-[3-[[4-[5-(trimethylazaniumyl)pentanoyl]benzoyl]amino]propyl]azanium (PubChem CID 158146250) has the molecular formula C29H45N3O2+2 and a molecular weight of 467.70 g/mol. Its IUPAC name is (4-ethylphenyl)methyl-dimethyl-[3-[[4-[5-(trimethylazaniumyl)pentanoyl]benzoyl]amino]propyl]azanium.
| Compound Name | (4-ethylphenyl)methyl-dimethyl-[3-[[4-[5-(trimethylazaniumyl)pentanoyl]benzoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 158146250 |
| Molecular Formula | C29H45N3O2+2 |
| Molecular Weight | 467.70 g/mol |
| Exact Mass | 467.35 |
| IUPAC Name | (4-ethylphenyl)methyl-dimethyl-[3-[[4-[5-(trimethylazaniumyl)pentanoyl]benzoyl]amino]propyl]azanium |
| SMILES | CCc1ccc(C[N+](C)(C)CCCNC(=O)c2ccc(C(=O)CCCC[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H44N3O2/c1-7-24-12-14-25(15-13-24)23-32(5,6)22-10-20-30-29(34)27-18-16-26(17-19-27)28(33)11-8-9-21-31(2,3)4/h12-19H,7-11,20-23H2,1-6H3/q+1/p+1 |
| InChIKey | XSZOMKIYRWUVNU-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|