C31H39N5O2+2 — CID 158146249
N-[3-[3-[(4-ethylphenyl)methyl]imidazol-3-ium-1-yl]propyl]-4-[5-(3-methylimidazol-3-ium-1-yl)pentanoyl]benzamide (PubChem CID 158146249) has the molecular formula C31H39N5O2+2 and a molecular weight of 513.69 g/mol. Its IUPAC name is N-[3-[3-[(4-ethylphenyl)methyl]imidazol-3-ium-1-yl]propyl]-4-[5-(3-methylimidazol-3-ium-1-yl)pentanoyl]benzamide.
| Compound Name | N-[3-[3-[(4-ethylphenyl)methyl]imidazol-3-ium-1-yl]propyl]-4-[5-(3-methylimidazol-3-ium-1-yl)pentanoyl]benzamide |
|---|---|
| PubChem CID | 158146249 |
| Molecular Formula | C31H39N5O2+2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | N-[3-[3-[(4-ethylphenyl)methyl]imidazol-3-ium-1-yl]propyl]-4-[5-(3-methylimidazol-3-ium-1-yl)pentanoyl]benzamide |
| SMILES | CCc1ccc(C[n+]2ccn(CCCNC(=O)c3ccc(C(=O)CCCCn4cc[n+](C)c4)cc3)c2)cc1 |
| InChI | InChI=1S/C31H38N5O2/c1-3-26-8-10-27(11-9-26)23-36-22-21-35(25-36)18-6-16-32-31(38)29-14-12-28(13-15-29)30(37)7-4-5-17-34-20-19-33(2)24-34/h8-15,19-22,24-25H,3-7,16-18,23H2,1-2H3/q+1/p+1 |
| InChIKey | NIYANWDADAUUQF-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|