C24H35ClN3O+ — CID 54212133
[4-(3-amino-5-chlorophenyl)-2-ethylbutyl]-(3-benzamidopropyl)-dimethylazanium (PubChem CID 54212133) has the molecular formula C24H35ClN3O+ and a molecular weight of 417.02 g/mol. Its IUPAC name is [4-(3-amino-5-chlorophenyl)-2-ethylbutyl]-(3-benzamidopropyl)-dimethylazanium.
| Compound Name | [4-(3-amino-5-chlorophenyl)-2-ethylbutyl]-(3-benzamidopropyl)-dimethylazanium |
|---|---|
| PubChem CID | 54212133 |
| Molecular Formula | C24H35ClN3O+ |
| Molecular Weight | 417.02 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | [4-(3-amino-5-chlorophenyl)-2-ethylbutyl]-(3-benzamidopropyl)-dimethylazanium |
| SMILES | CCC(CCc1cc(N)cc(Cl)c1)C[N+](C)(C)CCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H34ClN3O/c1-4-19(11-12-20-15-22(25)17-23(26)16-20)18-28(2,3)14-8-13-27-24(29)21-9-6-5-7-10-21/h5-7,9-10,15-17,19H,4,8,11-14,18,26H2,1-3H3/p+1 |
| InChIKey | PWQWEPBKZPJUTR-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.02 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|