C24H26Cl3N2S+ — CID 11642577
3-(5-chloro-2-phenylsulfanylanilino)propyl-[(3,4-dichlorophenyl)methyl]-dimethylazanium (PubChem CID 11642577) has the molecular formula C24H26Cl3N2S+ and a molecular weight of 480.91 g/mol. Its IUPAC name is 3-(5-chloro-2-phenylsulfanylanilino)propyl-[(3,4-dichlorophenyl)methyl]-dimethylazanium.
| Compound Name | 3-(5-chloro-2-phenylsulfanylanilino)propyl-[(3,4-dichlorophenyl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 11642577 |
| Molecular Formula | C24H26Cl3N2S+ |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 3-(5-chloro-2-phenylsulfanylanilino)propyl-[(3,4-dichlorophenyl)methyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCNc1cc(Cl)ccc1Sc1ccccc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H26Cl3N2S/c1-29(2,17-18-9-11-21(26)22(27)15-18)14-6-13-28-23-16-19(25)10-12-24(23)30-20-7-4-3-5-8-20/h3-5,7-12,15-16,28H,6,13-14,17H2,1-2H3/q+1 |
| InChIKey | XKYPHXFYBMMYEV-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|