C12H18Cl2N+ — CID 147750736
(3,4-dichlorophenyl)methyl-dimethyl-propan-2-ylazanium (PubChem CID 147750736) has the molecular formula C12H18Cl2N+ and a molecular weight of 247.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl-dimethyl-propan-2-ylazanium.
| Compound Name | (3,4-dichlorophenyl)methyl-dimethyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 147750736 |
| Molecular Formula | C12H18Cl2N+ |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (3,4-dichlorophenyl)methyl-dimethyl-propan-2-ylazanium |
| SMILES | CC(C)[N+](C)(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N/c1-9(2)15(3,4)8-10-5-6-11(13)12(14)7-10/h5-7,9H,8H2,1-4H3/q+1 |
| InChIKey | CIICRXJYRCTJEQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|