C11H16Cl2IN — CID 162747540
(3,4-dichlorophenyl)methyliodanuidyl-ethyl-dimethylazanium (PubChem CID 162747540) has the molecular formula C11H16Cl2IN and a molecular weight of 360.07 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyliodanuidyl-ethyl-dimethylazanium.
| Compound Name | (3,4-dichlorophenyl)methyliodanuidyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 162747540 |
| Molecular Formula | C11H16Cl2IN |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | (3,4-dichlorophenyl)methyliodanuidyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)[I-]Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2IN/c1-4-15(2,3)14-8-9-5-6-10(12)11(13)7-9/h5-7H,4,8H2,1-3H3 |
| InChIKey | OMPAKHNYBMOFSP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|