C11H16Cl3N — CID 154734522
(3,4-dichlorophenyl)methyl-ethyl-dimethylazanium chloride (PubChem CID 154734522) has the molecular formula C11H16Cl3N and a molecular weight of 268.62 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl-ethyl-dimethylazanium chloride.
| Compound Name | (3,4-dichlorophenyl)methyl-ethyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 154734522 |
| Molecular Formula | C11H16Cl3N |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (3,4-dichlorophenyl)methyl-ethyl-dimethylazanium chloride |
| SMILES | CC[N+](C)(C)Cc1ccc(Cl)c(Cl)c1.[Cl-] |
| InChI | InChI=1S/C11H16Cl2N.ClH/c1-4-14(2,3)8-9-5-6-10(12)11(13)7-9;/h5-7H,4,8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KKGRQRGEJGKMSI-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|